Difference between revisions of "PWY-7077"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-TOLUENECARBOXYLATE 4-TOLUENECARBOXYLATE] == * common-name: ** 4-toluenecarboxylate * smiles:...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Hypoxanthine-In-tRNAs-34s Hypoxanthine-In-tRNAs-34s] == * common-name: ** a hypoxanthine 34 in...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-TOLUENECARBOXYLATE 4-TOLUENECARBOXYLATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Hypoxanthine-In-tRNAs-34s Hypoxanthine-In-tRNAs-34s] ==
 
* common-name:
 
* common-name:
** 4-toluenecarboxylate
+
** a hypoxanthine 34 in trnas
* smiles:
 
** cc1(c=cc(=cc=1)c(=o)[o-])
 
* inchi-key:
 
** lpnbbfkouusudb-uhfffaoysa-m
 
* molecular-weight:
 
** 135.142
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13997]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8582]]
+
* [[RXN-13997]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-toluenecarboxylate}}
+
{{#set: common-name=a hypoxanthine 34 in trnas}}
{{#set: inchi-key=inchikey=lpnbbfkouusudb-uhfffaoysa-m}}
 
{{#set: molecular-weight=135.142}}
 

Revision as of 09:22, 27 August 2019

Metabolite Hypoxanthine-In-tRNAs-34s

  • common-name:
    • a hypoxanthine 34 in trnas

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality