Difference between revisions of "PWY-7082"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] ==
+== Pathway PWY-7082 ==
+* taxonomic-range:
+** tax-914
+** tax-1227
+** tax-35798
 * common-name:
-** 2,4-dinitrophenyl-s-glutathione
+** ammonia oxidation iv (autotrophic ammonia oxidizers)
-* smiles:
+== Reaction(s) found ==
-** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
+* [[1.10.2.2-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** fxeukvkgtkddiq-uwvggrqhsa-m
+* [NoneRXN-13572 RXN-13572]
-* molecular-weight:
+* [NoneRXN-21454 RXN-21454]
-** 472.406
+{{#set: taxonomic-range=tax-1227|tax-914|tax-35798}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=ammonia oxidation iv (autotrophic ammonia oxidizers)}}
-* [[GST-RXN]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.5}}
-* [[GST-RXN]]
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=2,4-dinitrophenyl-s-glutathione}}
-{{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}}
-{{#set: molecular-weight=472.406}}