Difference between revisions of "PWY-7082"

Revision as of 14:18, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNAs tRNAs] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-PYROPHOSPHATE THIAMINE-PYROPHOSPHATE] ==
 * common-name:
-** an uncharged trna
+** thiamine diphosphate
+* smiles:
+** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
+* inchi-key:
+** ayekofbpnlcajy-uhfffaoysa-l
+* molecular-weight:
+** 422.288
 == Reaction(s) known to consume the compound ==
+* [[RXN-12583]]
+* [[RXN-14037]]
+* [[RXN0-3542]]
 == Reaction(s) known to produce the compound ==
-* [[AMINOCYL-TRNA-HYDROLASE-RXN]]
+* [[PDHam2hi]]
-* [[RXN-15041]]
+* [[PDHam2mi]]
-* [[RXN0-6480]]
+* [[RXN-12508]]
+* [[RXN-14037]]
+* [[RXN0-3542]]
+* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
+* [[THIAMIN-TRIPHOSPHATASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=an uncharged trna}}
+{{#set: common-name=thiamine diphosphate}}
+{{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}}
+{{#set: molecular-weight=422.288}}