Difference between revisions of "PWY-7084"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] == * common-name: ** octoketide * smiles: ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=c...")
(Created page with "Category:pathway == Pathway PWY-7084 == * taxonomic-range: ** tax-2 * common-name: ** nitrifier denitrification == Reaction(s) found == * NITRITE-REDUCTASE-CYTOCHROME-RX...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] ==
+
== Pathway PWY-7084 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** octoketide
+
** nitrifier denitrification
* smiles:
+
== Reaction(s) found ==
** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3))
+
* [[NITRITE-REDUCTASE-CYTOCHROME-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** wfnzgunbscuxfx-uhfffaoysa-m
+
* [NoneNITRIC-OXIDE-REDUCTASE-RXN NITRIC-OXIDE-REDUCTASE-RXN]
* molecular-weight:
+
* [NoneRXN-13570 RXN-13570]
** 317.274
+
* [NoneRXN-12130 RXN-12130]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=nitrifier denitrification}}
* [[RXN-10734]]
+
{{#set: nb reaction found=1}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.25}}
{{#set: common-name=octoketide}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=wfnzgunbscuxfx-uhfffaoysa-m}}
 
{{#set: molecular-weight=317.274}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY-7084

  • taxonomic-range:
    • tax-2
  • common-name:
    • nitrifier denitrification

Reaction(s) found

Reaction(s) not found

  • [NoneNITRIC-OXIDE-REDUCTASE-RXN NITRIC-OXIDE-REDUCTASE-RXN]
  • [NoneRXN-13570 RXN-13570]
  • [NoneRXN-12130 RXN-12130]