Difference between revisions of "PWY-7089"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-814-24-TRIENOL 44-DIMETHYL-CHOLESTA-814-24-TRIENOL] == * common-name: ** 4...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * common-name: ** 1d-myo-inositol 6-monophosphate * smiles: ** c1(o)(c(o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-814-24-TRIENOL 44-DIMETHYL-CHOLESTA-814-24-TRIENOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] ==
 
* common-name:
 
* common-name:
** 4,4-dimethyl-cholesta-8,14,24-trienol
+
** 1d-myo-inositol 6-monophosphate
 
* smiles:
 
* smiles:
** cc(c)=cccc([ch]1(c2(c)(c(=cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
+
** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** lfqxezvyncbvdo-pbjlwwpksa-n
+
** inapmgsxuvuwaf-xcmzkkersa-l
 
* molecular-weight:
 
* molecular-weight:
** 410.682
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-306]]
+
* [[RXN-10954]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN3O-130]]
 
* [[RXN66-305]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4,4-dimethyl-cholesta-8,14,24-trienol}}
+
{{#set: common-name=1d-myo-inositol 6-monophosphate}}
{{#set: inchi-key=inchikey=lfqxezvyncbvdo-pbjlwwpksa-n}}
+
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-xcmzkkersa-l}}
{{#set: molecular-weight=410.682}}
+
{{#set: molecular-weight=258.121}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-6702

  • common-name:
    • 1d-myo-inositol 6-monophosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1)
  • inchi-key:
    • inapmgsxuvuwaf-xcmzkkersa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality