Difference between revisions of "PWY-7094"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine10-in-tRNA Guanine10-in-tRNA] ==
 * common-name:
-** (e)-cinnamoyl-coa
+** a guanine10 in trna
-* smiles:
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
-* inchi-key:
-** jvnvhnhitfvwix-kzkudurgsa-j
-* molecular-weight:
-** 893.648
 == Reaction(s) known to consume the compound ==
-* [[RXN-7645]]
+* [[RXN-12374]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-2001]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(e)-cinnamoyl-coa}}
+{{#set: common-name=a guanine10 in trna}}
-{{#set: inchi-key=inchikey=jvnvhnhitfvwix-kzkudurgsa-j}}
-{{#set: molecular-weight=893.648}}