Difference between revisions of "PWY-7102"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9096 CPD-9096] ==
+== Pathway PWY-7102 ==
+* taxonomic-range:
+** tax-2759
+** tax-1224
 * common-name:
-** bacteriopheophytin a
+** bisabolene biosynthesis (engineered)
-* smiles:
+== Reaction(s) found ==
-** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)cccc(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
+* [[FPPSYN-RXN]]
-* inchi-key:
+* [[GPPSYN-RXN]]
-** qgudpqyomulita-zasykxldsa-n
+* [[IPPISOM-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 888.221
+* [NoneRXN-8429 RXN-8429]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8549 RXN-8549]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-8550 RXN-8550]
-* [[RXN-17427]]
+{{#set: taxonomic-range=tax-1224|tax-2759}}
-* [[RXN-8796]]
+{{#set: common-name=bisabolene biosynthesis (engineered)}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=3}}
-{{#set: common-name=bacteriopheophytin a}}
+{{#set: completion rate=0.5}}
-{{#set: inchi-key=inchikey=qgudpqyomulita-zasykxldsa-n}}
+{{#set: nb total reaction=6}}
-{{#set: molecular-weight=888.221}}