Difference between revisions of "PWY-7104"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] == * common-name: ** (3e)-dec-3-enoyl-coa * smiles: ** ccccccc=ccc(=o)sccn...")
(Created page with "Category:pathway == Pathway PWY-7104 == * taxonomic-range: ** tax-2 * common-name: ** dtdp-l-megosamine biosynthesis == Reaction(s) found == * DTDPGLUCDEHYDRAT-RXN ==...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] ==
+
== Pathway PWY-7104 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** (3e)-dec-3-enoyl-coa
+
** dtdp-l-megosamine biosynthesis
* smiles:
+
== Reaction(s) found ==
** ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[DTDPGLUCDEHYDRAT-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** cqgvnmqhzqjnii-zjzqahhtsa-j
+
* [NoneRXN-13659 RXN-13659]
* molecular-weight:
+
* [NoneRXN-12404 RXN-12404]
** 915.738
+
* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-12943 RXN-12943]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-15233 RXN-15233]
* [[RXN-14803]]
+
* [NoneRXN-13667 RXN-13667]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-13660 RXN-13660]
{{#set: common-name=(3e)-dec-3-enoyl-coa}}
+
{{#set: taxonomic-range=tax-2}}
{{#set: inchi-key=inchikey=cqgvnmqhzqjnii-zjzqahhtsa-j}}
+
{{#set: common-name=dtdp-l-megosamine biosynthesis}}
{{#set: molecular-weight=915.738}}
+
{{#set: nb reaction found=1}}
 +
{{#set: completion rate=0.12}}
 +
{{#set: nb total reaction=8}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7104

  • taxonomic-range:
    • tax-2
  • common-name:
    • dtdp-l-megosamine biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-13659 RXN-13659]
  • [NoneRXN-12404 RXN-12404]
  • [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
  • [NoneRXN-12943 RXN-12943]
  • [NoneRXN-15233 RXN-15233]
  • [NoneRXN-13667 RXN-13667]
  • [NoneRXN-13660 RXN-13660]