Difference between revisions of "PWY-7104"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] ==
+== Pathway PWY-7104 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** trans-cinnamate
+** dtdp-l-megosamine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(=o)([o-])c=cc1(=cc=cc=c1)
+* [[DTDPGLUCDEHYDRAT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** wbywaxjhaxsjni-votsokgwsa-m
+* [NoneRXN-13659 RXN-13659]
-* molecular-weight:
+* [NoneRXN-12404 RXN-12404]
-** 147.153
+* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12943 RXN-12943]
-* [[RXN-2001]]
+* [NoneRXN-15233 RXN-15233]
-* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
+* [NoneRXN-13667 RXN-13667]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-13660 RXN-13660]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-2}}
-{{#set: common-name=trans-cinnamate}}
+{{#set: common-name=dtdp-l-megosamine biosynthesis}}
-{{#set: inchi-key=inchikey=wbywaxjhaxsjni-votsokgwsa-m}}
+{{#set: nb reaction found=1}}
-{{#set: molecular-weight=147.153}}
+{{#set: completion rate=0.12}}
+{{#set: nb total reaction=8}}