Difference between revisions of "PWY-7104"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == * common-name: ** trans-cinnamate * smiles: ** c(=o)([o-])c=cc1(=cc=cc=c1)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=holo-Transcarboxylases holo-Transcarboxylases] == * common-name: ** a holo-[methylmalonyl-coa:p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=holo-Transcarboxylases holo-Transcarboxylases] ==
 
* common-name:
 
* common-name:
** trans-cinnamate
+
** a holo-[methylmalonyl-coa:pyruvate carboxytransferase]
* smiles:
 
** c(=o)([o-])c=cc1(=cc=cc=c1)
 
* inchi-key:
 
** wbywaxjhaxsjni-votsokgwsa-m
 
* molecular-weight:
 
** 147.153
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2001]]
 
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[6.3.4.9-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-cinnamate}}
+
{{#set: common-name=a holo-[methylmalonyl-coa:pyruvate carboxytransferase]}}
{{#set: inchi-key=inchikey=wbywaxjhaxsjni-votsokgwsa-m}}
 
{{#set: molecular-weight=147.153}}
 

Revision as of 14:18, 26 August 2019

Metabolite holo-Transcarboxylases

  • common-name:
    • a holo-[methylmalonyl-coa:pyruvate carboxytransferase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a holo-[methylmalonyl-coa:pyruvate carboxytransferase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.