Difference between revisions of "PWY-7111"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17365 CPD-17365] == * common-name: ** (4z,7z,10z,13z,16z)-docosapentaenoyl-coa * smiles: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG+2 MG+2] == * common-name: ** mg2+ * smiles: ** [mg++] * inchi-key: ** jlvvsxflkojniy-uhfffao...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17365 CPD-17365] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG+2 MG+2] ==
 
* common-name:
 
* common-name:
** (4z,7z,10z,13z,16z)-docosapentaenoyl-coa
+
** mg2+
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** [mg++]
 
* inchi-key:
 
* inchi-key:
** qkbtyzdpvnterq-uwvcyphhsa-j
+
** jlvvsxflkojniy-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1075.997
+
** 24.305
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ExchangeSeed-MG+2]]
 +
* [[RXN1F-20]]
 +
* [[TransportSeed-MG+2]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17116]]
+
* [[ExchangeSeed-MG+2]]
 +
* [[TransportSeed-MG+2]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4z,7z,10z,13z,16z)-docosapentaenoyl-coa}}
+
{{#set: common-name=mg2+}}
{{#set: inchi-key=inchikey=qkbtyzdpvnterq-uwvcyphhsa-j}}
+
{{#set: inchi-key=inchikey=jlvvsxflkojniy-uhfffaoysa-n}}
{{#set: molecular-weight=1075.997}}
+
{{#set: molecular-weight=24.305}}

Revision as of 09:22, 27 August 2019

Metabolite MG+2

  • common-name:
    • mg2+
  • smiles:
    • [mg++]
  • inchi-key:
    • jlvvsxflkojniy-uhfffaoysa-n
  • molecular-weight:
    • 24.305

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality