Difference between revisions of "PWY-7118"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-with-5-taurinomethyl-2-thiouridine tRNA-with-5-taurinomethyl-2-thiouridine] ==
 * common-name:
-** 4-hydroxy-2-nonenal-[l-cys] conjugate
+** a 5-taurinomethyl-2-thiouridine in trna
-* smiles:
-** cccccc(o)c(cc=o)scc([n+])c(=o)[o-]
-* inchi-key:
-** salpdushmtyyoh-uhfffaoysa-n
-* molecular-weight:
-** 277.378
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[RXN-13677]]
+* [[RXN-16821]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=4-hydroxy-2-nonenal-[l-cys] conjugate}}
+{{#set: common-name=a 5-taurinomethyl-2-thiouridine in trna}}
-{{#set: inchi-key=inchikey=salpdushmtyyoh-uhfffaoysa-n}}
-{{#set: molecular-weight=277.378}}