Difference between revisions of "PWY-7119"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-5-METHOXY-TRYPTAMINE N-ACETYL-5-METHOXY-TRYPTAMINE] == * common-name: ** melatonin * s...")
(Created page with "Category:pathway == Pathway PWY-7119 == * taxonomic-range: ** tax-4751 * common-name: ** sphingolipid recycling and degradation (yeast) == Reaction(s) found == * RXN-137...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-5-METHOXY-TRYPTAMINE N-ACETYL-5-METHOXY-TRYPTAMINE] ==
+
== Pathway PWY-7119 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** melatonin
+
** sphingolipid recycling and degradation (yeast)
* smiles:
+
== Reaction(s) found ==
** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2))
+
* [[RXN-13729]]
* inchi-key:
+
* [[RXN3O-458]]
** drlfmbdrbrzale-uhfffaoysa-n
+
* [[SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN]]
* molecular-weight:
+
* [[SPHINGANINE-KINASE-RXN]]
** 232.282
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-13730 RXN-13730]
* [[RXN-11056]]
+
* [NoneDHS-PHOSPHATASE-RXN DHS-PHOSPHATASE-RXN]
* [[RXN-11057]]
+
* [NoneRXN-20651 RXN-20651]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-13731 RXN-13731]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-9623 RXN-9623]
{{#set: common-name=melatonin}}
+
* [NoneRXN-13733 RXN-13733]
{{#set: inchi-key=inchikey=drlfmbdrbrzale-uhfffaoysa-n}}
+
* [NoneCERAMIDASE-YEAST-RXN CERAMIDASE-YEAST-RXN]
{{#set: molecular-weight=232.282}}
+
* [NoneRXN3O-504 RXN3O-504]
 +
* [NoneRXN-20649 RXN-20649]
 +
* [NoneRXN-13732 RXN-13732]
 +
* [NoneRXN-16655 RXN-16655]
 +
* [NoneRXN-20650 RXN-20650]
 +
{{#set: taxonomic-range=tax-4751}}
 +
{{#set: common-name=sphingolipid recycling and degradation (yeast)}}
 +
{{#set: nb reaction found=4}}
 +
{{#set: completion rate=0.25}}
 +
{{#set: nb total reaction=16}}

Latest revision as of 11:00, 18 March 2021

Pathway PWY-7119

  • taxonomic-range:
    • tax-4751
  • common-name:
    • sphingolipid recycling and degradation (yeast)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-13730 RXN-13730]
  • [NoneDHS-PHOSPHATASE-RXN DHS-PHOSPHATASE-RXN]
  • [NoneRXN-20651 RXN-20651]
  • [NoneRXN-13731 RXN-13731]
  • [NoneRXN-9623 RXN-9623]
  • [NoneRXN-13733 RXN-13733]
  • [NoneCERAMIDASE-YEAST-RXN CERAMIDASE-YEAST-RXN]
  • [NoneRXN3O-504 RXN3O-504]
  • [NoneRXN-20649 RXN-20649]
  • [NoneRXN-13732 RXN-13732]
  • [NoneRXN-16655 RXN-16655]
  • [NoneRXN-20650 RXN-20650]