Difference between revisions of "PWY-7124"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * common-name: ** d-glutamate * smiles: ** c(ccc(c(=o)[o-])[n+])([o-])=o * inch...")
(Created page with "Category:pathway == Pathway PWY-7124 == * taxonomic-range: ** tax-4930 ** tax-2 * common-name: ** ethylene biosynthesis v (engineered) == Reaction(s) found == * 2PGADEHY...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] ==
+
== Pathway PWY-7124 ==
 +
* taxonomic-range:
 +
** tax-4930
 +
** tax-2
 
* common-name:
 
* common-name:
** d-glutamate
+
** ethylene biosynthesis v (engineered)
* smiles:
+
== Reaction(s) found ==
** c(ccc(c(=o)[o-])[n+])([o-])=o
+
* [[2PGADEHYDRAT-RXN]]
* inchi-key:
+
* [[3PGAREARR-RXN]]
** whuutdbjxjrkmk-gsvougtgsa-m
+
* [[ACONITATEDEHYDR-RXN]]
* molecular-weight:
+
* [[ACONITATEHYDR-RXN]]
** 146.122
+
* [[CITSYN-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[ISOCITDEH-RXN]]
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
+
* [[PEPCARBOX-RXN]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) not found ==
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
+
* [NoneRXN-12538 RXN-12538]
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-2|tax-4930}}
{{#set: common-name=d-glutamate}}
+
{{#set: common-name=ethylene biosynthesis v (engineered)}}
{{#set: inchi-key=inchikey=whuutdbjxjrkmk-gsvougtgsa-m}}
+
{{#set: nb reaction found=7}}
{{#set: molecular-weight=146.122}}
+
{{#set: completion rate=0.88}}
 +
{{#set: nb total reaction=8}}

Latest revision as of 11:00, 18 March 2021

Pathway PWY-7124

  • taxonomic-range:
    • tax-4930
    • tax-2
  • common-name:
    • ethylene biosynthesis v (engineered)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12538 RXN-12538]