Difference between revisions of "PWY-7130"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] ==
+== Pathway PWY-7130 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 4-hydroxybenzoate
+** l-glucose degradation
-* smiles:
+== Reaction(s) found ==
-** c(c1(c=cc(=cc=1)o))(=o)[o-]
+* [[DEHYDDEOXPHOSGALACT-ALDOL-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** fjkrolugyxjwqn-uhfffaoysa-m
+* [NoneRXN-13774 RXN-13774]
-* molecular-weight:
+* [NoneDEHYDDEOXGALACTKIN-RXN DEHYDDEOXGALACTKIN-RXN]
-** 137.115
+* [NoneRXN-13775 RXN-13775]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-13771 RXN-13771]
-* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
+* [NoneRXN-13772 RXN-13772]
-* [[RXN-9003]]
+* [NoneRXN-13773 RXN-13773]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=l-glucose degradation}}
-{{#set: common-name=4-hydroxybenzoate}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}}
+{{#set: completion rate=0.14}}
-{{#set: molecular-weight=137.115}}
+{{#set: nb total reaction=7}}