Difference between revisions of "PWY-7130"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] ==
+== Pathway PWY-7154 ==
+* taxonomic-range:
+** tax-3041
 * common-name:
-** 4-hydroxybenzoate
+** ergosterol biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** c(c1(c=cc(=cc=1)o))(=o)[o-]
+* [[CYCLOARTENOL-SYNTHASE-RXN]]
-* inchi-key:
+* [[RXN-13883]]
-** fjkrolugyxjwqn-uhfffaoysa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-20446 RXN-20446]
-** 137.115
+* [NoneRXN-13884 RXN-13884]
-== Reaction(s) known to consume the compound ==
+* [None2.1.1.142-RXN 2.1.1.142-RXN]
-* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
+* [NoneRXN-20414 RXN-20414]
-* [[RXN-9003]]
+* [NoneRXN-13879 RXN-13879]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-13882 RXN-13882]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-20445 RXN-20445]
-{{#set: common-name=4-hydroxybenzoate}}
+* [NoneRXN-20412 RXN-20412]
-{{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}}
+* [NoneRXN-20411 RXN-20411]
-{{#set: molecular-weight=137.115}}
+* [NoneRXN-13881 RXN-13881]
+{{#set: taxonomic-range=tax-3041}}
+{{#set: common-name=ergosterol biosynthesis ii}}
+{{#set: nb reaction found=2}}
+{{#set: completion rate=0.18}}
+{{#set: nb total reaction=11}}