Difference between revisions of "PWY-7153"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLIGOPEPTIDES OLIGOPEPTIDES] == * common-name: ** an oligopeptide == Reaction(s) known to consu...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == * common-name: ** β-l-fucose 1-phosphate * smiles: ** cc1(oc(op(=o)([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLIGOPEPTIDES OLIGOPEPTIDES] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] ==
 
* common-name:
 
* common-name:
** an oligopeptide
+
** β-l-fucose 1-phosphate
 +
* smiles:
 +
** cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
 +
* inchi-key:
 +
** ptvxqarclqpgir-sxuwkvjysa-l
 +
* molecular-weight:
 +
** 242.122
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.4.16.2-RXN]]
 
* [[3.4.21.83-RXN]]
 
* [[3.4.24.70-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[FUCOKINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an oligopeptide}}
+
{{#set: common-name=β-l-fucose 1-phosphate}}
 +
{{#set: inchi-key=inchikey=ptvxqarclqpgir-sxuwkvjysa-l}}
 +
{{#set: molecular-weight=242.122}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-488

  • common-name:
    • β-l-fucose 1-phosphate
  • smiles:
    • cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
  • inchi-key:
    • ptvxqarclqpgir-sxuwkvjysa-l
  • molecular-weight:
    • 242.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality