Difference between revisions of "PWY-7154"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19217 CPD-19217] == * common-name: ** s-(hydroxysulfenamide)-glutathione * smiles: ** c(sno...")
 
(Created page with "Category:pathway == Pathway PWY-7154 == * taxonomic-range: ** tax-3041 * common-name: ** ergosterol biosynthesis ii == Reaction(s) found == * CYCLOARTENOL-SYNTHASE-RXN...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19217 CPD-19217] ==
+
== Pathway PWY-7154 ==
 +
* taxonomic-range:
 +
** tax-3041
 
* common-name:
 
* common-name:
** s-(hydroxysulfenamide)-glutathione
+
** ergosterol biosynthesis ii
* smiles:
+
== Reaction(s) found ==
** c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
* [[CYCLOARTENOL-SYNTHASE-RXN]]
* inchi-key:
+
* [[RXN-13883]]
** zoiidzwlsvvtgq-wdskdsinsa-m
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-13881 RXN-13881]
** 337.327
+
* [NoneRXN-13879 RXN-13879]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-13884 RXN-13884]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-20445 RXN-20445]
* [[RXN-17884]]
+
* [NoneRXN-20412 RXN-20412]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-20411 RXN-20411]
{{#set: common-name=s-(hydroxysulfenamide)-glutathione}}
+
* [NoneRXN-20414 RXN-20414]
{{#set: inchi-key=inchikey=zoiidzwlsvvtgq-wdskdsinsa-m}}
+
* [None2.1.1.142-RXN 2.1.1.142-RXN]
{{#set: molecular-weight=337.327}}
+
* [NoneRXN-20446 RXN-20446]
 +
* [NoneRXN-13882 RXN-13882]
 +
{{#set: taxonomic-range=tax-3041}}
 +
{{#set: common-name=ergosterol biosynthesis ii}}
 +
{{#set: nb reaction found=2}}
 +
{{#set: completion rate=0.18}}
 +
{{#set: nb total reaction=11}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-7154

  • taxonomic-range:
    • tax-3041
  • common-name:
    • ergosterol biosynthesis ii

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-13881 RXN-13881]
  • [NoneRXN-13879 RXN-13879]
  • [NoneRXN-13884 RXN-13884]
  • [NoneRXN-20445 RXN-20445]
  • [NoneRXN-20412 RXN-20412]
  • [NoneRXN-20411 RXN-20411]
  • [NoneRXN-20414 RXN-20414]
  • [None2.1.1.142-RXN 2.1.1.142-RXN]
  • [NoneRXN-20446 RXN-20446]
  • [NoneRXN-13882 RXN-13882]