Difference between revisions of "PWY-7155"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] ==
+== Pathway PWY-7155 ==
+* taxonomic-range:
+** tax-3041
 * common-name:
-** methyl (indol-3-yl)acetate
+** 7-dehydroporiferasterol biosynthesis
-* smiles:
+== Reaction(s) found ==
-** coc(=o)cc2(c1(c(=cc=cc=1)nc=2))
+* [[CYCLOARTENOL-SYNTHASE-RXN]]
-* inchi-key:
+* [[CYCLOEUCALENOL-CYCLOISOMERASE-RXN]]
-** kthadmdgdnyqrx-uhfffaoysa-n
+* [[RXN-13892]]
-* molecular-weight:
+* [[RXN-4021]]
-** 189.213
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-13893 RXN-13893]
-* [[RXN-10711]]
+* [NoneRXN-13891 RXN-13891]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-13896 RXN-13896]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-13895 RXN-13895]
-{{#set: common-name=methyl (indol-3-yl)acetate}}
+* [NoneRXN-13894 RXN-13894]
-{{#set: inchi-key=inchikey=kthadmdgdnyqrx-uhfffaoysa-n}}
+{{#set: taxonomic-range=tax-3041}}
-{{#set: molecular-weight=189.213}}
+{{#set: common-name=7-dehydroporiferasterol biosynthesis}}
+{{#set: nb reaction found=4}}
+{{#set: completion rate=0.67}}
+{{#set: nb total reaction=6}}