Difference between revisions of "PWY-7155"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == * common-name: ** methyl (indol-3-yl)acetate * smiles: ** coc(=o)cc2(c1...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glucosylated-Glucose-Acceptors Non-Glucosylated-Glucose-Acceptors] == * common-name: ** a n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glucosylated-Glucose-Acceptors Non-Glucosylated-Glucose-Acceptors] ==
 
* common-name:
 
* common-name:
** methyl (indol-3-yl)acetate
+
** a non glucosylated d-glucose acceptor
* smiles:
 
** coc(=o)cc2(c1(c(=cc=cc=1)nc=2))
 
* inchi-key:
 
** kthadmdgdnyqrx-uhfffaoysa-n
 
* molecular-weight:
 
** 189.213
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10711]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.2.1.21-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methyl (indol-3-yl)acetate}}
+
{{#set: common-name=a non glucosylated d-glucose acceptor}}
{{#set: inchi-key=inchikey=kthadmdgdnyqrx-uhfffaoysa-n}}
 
{{#set: molecular-weight=189.213}}
 

Revision as of 14:19, 26 August 2019

Metabolite Non-Glucosylated-Glucose-Acceptors

  • common-name:
    • a non glucosylated d-glucose acceptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality