Difference between revisions of "PWY-7161"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENOYL-COA LINOLENOYL-COA] == * common-name: ** α-linolenoyl-coa * smiles: ** ccc=ccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-CD-Apo-SP-Complex S-CD-Apo-SP-Complex] == * common-name: ** an s-sulfanyl-[cysteine desulfura...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENOYL-COA LINOLENOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-CD-Apo-SP-Complex S-CD-Apo-SP-Complex] ==
 
* common-name:
 
* common-name:
** α-linolenoyl-coa
+
** an s-sulfanyl-[cysteine desulfurase]-[disordered-form scaffold protein] complex
* smiles:
 
** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3)
 
* inchi-key:
 
** omkfkbgzhnjnex-kzwmewpfsa-j
 
* molecular-weight:
 
** 1023.921
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13426]]
+
* [[RXN-14384]]
* [[RXN-13441]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LINOLENOYL-RXN]]
 
* [[LNLNCACOAL]]
 
* [[llcoas]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-linolenoyl-coa}}
+
{{#set: common-name=an s-sulfanyl-[cysteine desulfurase]-[disordered-form scaffold protein] complex}}
{{#set: inchi-key=inchikey=omkfkbgzhnjnex-kzwmewpfsa-j}}
 
{{#set: molecular-weight=1023.921}}
 

Revision as of 09:22, 27 August 2019

Metabolite S-CD-Apo-SP-Complex

  • common-name:
    • an s-sulfanyl-[cysteine desulfurase]-[disordered-form scaffold protein] complex

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an s-sulfanyl-[cysteine desulfurase]-[disordered-form scaffold protein] complex" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.