Difference between revisions of "PWY-7163"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2474 CPD0-2474] ==
+== Pathway PWY-7163 ==
+* taxonomic-range:
+** tax-91827
 * common-name:
-** (s)-nadphx
+** polymethylated kaempferol biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
+* [[RXN-13935]]
-* inchi-key:
+== Reaction(s) not found ==
-** szkxtjuokargiy-vphrtnkssa-j
+* [None2.1.1.155-RXN 2.1.1.155-RXN]
-* molecular-weight:
+* [NoneRXN-13936 RXN-13936]
-** 759.41
+* [NoneRXN-13937 RXN-13937]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-91827}}
-* [[RXN-13139]]
+{{#set: common-name=polymethylated kaempferol biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-13139]]
+{{#set: completion rate=0.25}}
-* [[RXN-13142]]
+{{#set: nb total reaction=4}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-nadphx}}
-{{#set: inchi-key=inchikey=szkxtjuokargiy-vphrtnkssa-j}}
-{{#set: molecular-weight=759.41}}