Difference between revisions of "PWY-7168"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINONE-8 UBIQUINONE-8] == * common-name: ** ubiquinone-8 * smiles: ** cc(c)=cccc(c)=cccc(c)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * common-name: ** pregn-5-ene-3,20-dione-17-ol * smiles: ** cc(=o)c4(o)(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINONE-8 UBIQUINONE-8] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] ==
 
* common-name:
 
* common-name:
** ubiquinone-8
+
** pregn-5-ene-3,20-dione-17-ol
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
+
** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4))
 
* inchi-key:
 
* inchi-key:
** icfizjqgjajrsu-sghxuwjisa-n
+
** rcfjdvcranozel-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 727.121
+
** 330.466
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R00281]]
+
* [[RXN66-350]]
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R00281]]
+
* [[RXN66-350]]
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinone-8}}
+
{{#set: common-name=pregn-5-ene-3,20-dione-17-ol}}
{{#set: inchi-key=inchikey=icfizjqgjajrsu-sghxuwjisa-n}}
+
{{#set: inchi-key=inchikey=rcfjdvcranozel-uhfffaoysa-n}}
{{#set: molecular-weight=727.121}}
+
{{#set: molecular-weight=330.466}}

Revision as of 14:18, 26 August 2019

Metabolite CPD66-27

  • common-name:
    • pregn-5-ene-3,20-dione-17-ol
  • smiles:
    • cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4))
  • inchi-key:
    • rcfjdvcranozel-uhfffaoysa-n
  • molecular-weight:
    • 330.466

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality