Difference between revisions of "PWY-7168"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8083 CPD-8083] ==
+== Pathway PWY-7734 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 1-18:2-2-18:3-digalactosyldiacylglycerol
+** quinoxaline-2-carboxylate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
+* [[RXN-17150]]
-* inchi-key:
+== Reaction(s) not found ==
-** gkshydzifvnlss-ipdwfasdsa-n
+* [NoneRXN-17147 RXN-17147]
-* molecular-weight:
+* [NoneRXN-17144 RXN-17144]
-** 939.231
+* [NoneRXN-17148 RXN-17148]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-17152 RXN-17152]
-* [[RXN-8314]]
+* [NoneRXN-17145 RXN-17145]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-17154 RXN-17154]
-* [[RXN-8313]]
+* [NoneRXN-17146 RXN-17146]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-17149 RXN-17149]
-{{#set: common-name=1-18:2-2-18:3-digalactosyldiacylglycerol}}
+* [NoneRXN-17153 RXN-17153]
-{{#set: inchi-key=inchikey=gkshydzifvnlss-ipdwfasdsa-n}}
+{{#set: taxonomic-range=tax-2}}
-{{#set: molecular-weight=939.231}}
+{{#set: common-name=quinoxaline-2-carboxylate biosynthesis}}
+{{#set: nb reaction found=1}}
+{{#set: completion rate=0.1}}
+{{#set: nb total reaction=10}}