Difference between revisions of "PWY-7170"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10576 CPD-10576] ==
+== Pathway PWY-7170 ==
+* taxonomic-range:
+** tax-3041
+** tax-33090
 * common-name:
-** 4-chlorosalicylate
+** phytochromobilin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(c1(c=cc(cl)=cc=1o))([o-])=o
+* [[1.3.7.4-RXN]]
-* inchi-key:
+* [[RXN-17523]]
-** lwxfczxrfbuoor-uhfffaoysa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-13968 RXN-13968]
-** 171.56
+{{#set: taxonomic-range=tax-3041|tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=phytochromobilin biosynthesis}}
-* [[RXN-9912]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.67}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=4-chlorosalicylate}}
-{{#set: inchi-key=inchikey=lwxfczxrfbuoor-uhfffaoysa-m}}
-{{#set: molecular-weight=171.56}}