Difference between revisions of "PWY-7170"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * smiles: ** cc(c)=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10576 CPD-10576] == * common-name: ** 4-chlorosalicylate * smiles: ** c(c1(c=cc(cl)=cc=1o))...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10576 CPD-10576] == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-chlorosalicylate |
* smiles: | * smiles: | ||
− | ** | + | ** c(c1(c=cc(cl)=cc=1o))([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lwxfczxrfbuoor-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 171.56 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-9912]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-chlorosalicylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lwxfczxrfbuoor-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=171.56}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-10576
- common-name:
- 4-chlorosalicylate
- smiles:
- c(c1(c=cc(cl)=cc=1o))([o-])=o
- inchi-key:
- lwxfczxrfbuoor-uhfffaoysa-m
- molecular-weight:
- 171.56