Difference between revisions of "PWY-7174"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_I COPROPORPHYRINOGEN_I] == * common-name: ** coproporphyrinogen i * smiles:...")
(Created page with "Category:pathway == Pathway PWY-7646 == * taxonomic-range: ** tax-2 * common-name: ** dermatan sulfate degradation i (bacterial) == Reaction(s) found == * RXN-12178 ==...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_I COPROPORPHYRINOGEN_I] ==
+
== Pathway PWY-7646 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** coproporphyrinogen i
+
** dermatan sulfate degradation i (bacterial)
* smiles:
+
== Reaction(s) found ==
** cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc([o-])=o)c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
+
* [[RXN-12178]]
* inchi-key:
+
== Reaction(s) not found ==
** wiuggjkhyqignh-uhfffaoysa-j
+
* [None4.2.2.19-RXN 4.2.2.19-RXN]
* molecular-weight:
+
* [NoneRXN-11577 RXN-11577]
** 656.734
+
* [NoneCHONDRO-4-SULFATASE-RXN CHONDRO-4-SULFATASE-RXN]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=dermatan sulfate degradation i (bacterial)}}
* [[RXN-10642]]
+
{{#set: nb reaction found=1}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.25}}
{{#set: common-name=coproporphyrinogen i}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=wiuggjkhyqignh-uhfffaoysa-j}}
 
{{#set: molecular-weight=656.734}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-7646

  • taxonomic-range:
    • tax-2
  • common-name:
    • dermatan sulfate degradation i (bacterial)

Reaction(s) found

Reaction(s) not found

  • [None4.2.2.19-RXN 4.2.2.19-RXN]
  • [NoneRXN-11577 RXN-11577]
  • [NoneCHONDRO-4-SULFATASE-RXN CHONDRO-4-SULFATASE-RXN]