Difference between revisions of "PWY-7177"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * common-name: ** cis-coumarinic acid-β-d-glucoside * smiles: ** c(c...")
(Created page with "Category:pathway == Pathway PWY-7177 == * taxonomic-range: ** tax-2 ** tax-2759 * common-name: ** utp and ctp dephosphorylation ii == Reaction(s) found == * CTPSYN-RXN...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] ==
+
== Pathway PWY-7177 ==
 +
* taxonomic-range:
 +
** tax-2
 +
** tax-2759
 
* common-name:
 
* common-name:
** cis-coumarinic acid-β-d-glucoside
+
** utp and ctp dephosphorylation ii
* smiles:
+
== Reaction(s) found ==
** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
+
* [[CTPSYN-RXN]]
* inchi-key:
+
* [[RXN-12199]]
** gvriyimnjgulcz-qlfwqtqqsa-m
+
* [[RXN-12200]]
* molecular-weight:
+
== Reaction(s) not found ==
** 325.294
+
All reactions of this pathways are in present
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2|tax-2759}}
* [[RXN-8036]]
+
{{#set: common-name=utp and ctp dephosphorylation ii}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=1.0}}
{{#set: common-name=cis-coumarinic acid-β-d-glucoside}}
+
{{#set: nb total reaction=3}}
{{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}}
 
{{#set: molecular-weight=325.294}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7177

  • taxonomic-range:
    • tax-2
    • tax-2759
  • common-name:
    • utp and ctp dephosphorylation ii

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present