Difference between revisions of "PWY-7177"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * common-name: ** cis-coumarinic acid-β-d-glucoside * smiles: ** c(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine26-in-tRNA Guanine26-in-tRNA] == * common-name: ** a guanine26 in trna == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine26-in-tRNA Guanine26-in-tRNA] ==
 
* common-name:
 
* common-name:
** cis-coumarinic acid-β-d-glucoside
+
** a guanine26 in trna
* smiles:
 
** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
 
* inchi-key:
 
** gvriyimnjgulcz-qlfwqtqqsa-m
 
* molecular-weight:
 
** 325.294
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8036]]
+
* [[RXN-12375]]
 +
* [[RXN-12377]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-coumarinic acid-β-d-glucoside}}
+
{{#set: common-name=a guanine26 in trna}}
{{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}}
 
{{#set: molecular-weight=325.294}}
 

Revision as of 09:22, 27 August 2019

Metabolite Guanine26-in-tRNA

  • common-name:
    • a guanine26 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality