Difference between revisions of "PWY-7182"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == * common-name: ** biliverdin-ix-α * smiles: ** c=cc1(c(nc(c(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18319 CPD-18319] == * common-name: ** n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18319 CPD-18319] ==
 
* common-name:
 
* common-name:
** biliverdin-ix-α
+
** n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate
 
* smiles:
 
* smiles:
** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o))
+
** c(nc(=o)c1(oc(c(=o)n)1))c([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** qbuvfdktzjnupp-msgwkzgbsa-l
+
** lqrxqgmibgpnby-pzgqecojsa-n
 
* molecular-weight:
 
* molecular-weight:
** 580.639
+
** 217.181
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.3.7.2-RXN]]
+
* [[RXN-16991]]
* [[1.3.7.4-RXN]]
 
* [[R05818]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
 
* [[R05818]]
 
* [[RXN-17523]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=biliverdin-ix-α}}
+
{{#set: common-name=n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate}}
{{#set: inchi-key=inchikey=qbuvfdktzjnupp-msgwkzgbsa-l}}
+
{{#set: inchi-key=inchikey=lqrxqgmibgpnby-pzgqecojsa-n}}
{{#set: molecular-weight=580.639}}
+
{{#set: molecular-weight=217.181}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-18319

  • common-name:
    • n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate
  • smiles:
    • c(nc(=o)c1(oc(c(=o)n)1))c([n+])c(=o)[o-]
  • inchi-key:
    • lqrxqgmibgpnby-pzgqecojsa-n
  • molecular-weight:
    • 217.181

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality