Difference between revisions of "PWY-7182"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18319 CPD-18319] == * common-name: ** n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P3 DIHYDRONEOPTERIN-P3] == * common-name: ** 7,8-dihydroneopterin 3'-triphosph...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P3 DIHYDRONEOPTERIN-P3] == |
* common-name: | * common-name: | ||
− | ** | + | ** 7,8-dihydroneopterin 3'-triphosphate |
* smiles: | * smiles: | ||
− | ** c(nc(=o) | + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** dgguvlxvlhaagt-xinawcovsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 491.141 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[4.2.3.12-RXN]] |
+ | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[GTP-CYCLOHYDRO-I-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=7,8-dihydroneopterin 3'-triphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dgguvlxvlhaagt-xinawcovsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=491.141}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite DIHYDRONEOPTERIN-P3
- common-name:
- 7,8-dihydroneopterin 3'-triphosphate
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
- inchi-key:
- dgguvlxvlhaagt-xinawcovsa-j
- molecular-weight:
- 491.141