Difference between revisions of "PWY-7182"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P3 DIHYDRONEOPTERIN-P3] ==
+== Pathway ANAPHENOXI-PWY ==
+* taxonomic-range:
+** tax-4751
+** tax-1224
 * common-name:
-** 7,8-dihydroneopterin 3'-triphosphate
+** l-phenylalanine degradation ii (anaerobic)
-* smiles:
+== Reaction(s) found ==
-** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
+* [[PHEAMINOTRANS-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** dgguvlxvlhaagt-xinawcovsa-j
+* [NoneRXN-10814 RXN-10814]
-* molecular-weight:
+* [NonePHENYLPYRUVATE-DECARBOXYLASE-RXN PHENYLPYRUVATE-DECARBOXYLASE-RXN]
-** 491.141
+* [NonePHENDEHYD-RXN PHENDEHYD-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-1224|tax-4751}}
-* [[4.2.3.12-RXN]]
+{{#set: common-name=l-phenylalanine degradation ii (anaerobic)}}
-* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-* [[GTP-CYCLOHYDRO-I-RXN]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=7,8-dihydroneopterin 3'-triphosphate}}
-{{#set: inchi-key=inchikey=dgguvlxvlhaagt-xinawcovsa-j}}
-{{#set: molecular-weight=491.141}}