Difference between revisions of "PWY-7184"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == * common-name: ** n-acetyl-serotonin glucuronide * smiles: ** cc(=o)ncc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4161 CPD-4161] == * common-name: ** brassicasterol * smiles: ** cc(c)c(c)c=cc(c)[ch]3(cc[ch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4161 CPD-4161] ==
 
* common-name:
 
* common-name:
** n-acetyl-serotonin glucuronide
+
** brassicasterol
 
* smiles:
 
* smiles:
** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
+
** cc(c)c(c)c=cc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** drkqfnyksnwotc-rngzqalnsa-m
+
** oilxmjhpfnggto-zauypbdwsa-n
 
* molecular-weight:
 
* molecular-weight:
** 393.372
+
** 398.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12125]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11060]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-serotonin glucuronide}}
+
{{#set: common-name=brassicasterol}}
{{#set: inchi-key=inchikey=drkqfnyksnwotc-rngzqalnsa-m}}
+
{{#set: inchi-key=inchikey=oilxmjhpfnggto-zauypbdwsa-n}}
{{#set: molecular-weight=393.372}}
+
{{#set: molecular-weight=398.671}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-4161

  • common-name:
    • brassicasterol
  • smiles:
    • cc(c)c(c)c=cc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • oilxmjhpfnggto-zauypbdwsa-n
  • molecular-weight:
    • 398.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality