Difference between revisions of "PWY-7185"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAMP CAMP] == * common-name: ** cyclic-amp * smiles: ** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc...")
(Created page with "Category:pathway == Pathway PWY-7185 == * taxonomic-range: ** tax-2157 ** tax-2759 ** tax-2 * common-name: ** utp and ctp dephosphorylation i == Reaction(s) found == * C...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAMP CAMP] ==
+
== Pathway PWY-7185 ==
 +
* taxonomic-range:
 +
** tax-2157
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** cyclic-amp
+
** utp and ctp dephosphorylation i
* smiles:
+
== Reaction(s) found ==
** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34))
+
* [[CTPSYN-RXN]]
* inchi-key:
+
* [[RXN-12199]]
** ivomouwhdpkrll-kqynxxcusa-m
+
* [[RXN-12200]]
* molecular-weight:
+
* [[RXN-14025]]
** 328.201
+
* [[RXN-14026]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
* [[RXN0-5038]]
+
* [NoneRXN-12196 RXN-12196]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-12198 RXN-12198]
* [[ADENYLATECYC-RXN]]
+
* [NoneRXN-12195 RXN-12195]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-12197 RXN-12197]
{{#set: common-name=cyclic-amp}}
+
{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
{{#set: inchi-key=inchikey=ivomouwhdpkrll-kqynxxcusa-m}}
+
{{#set: common-name=utp and ctp dephosphorylation i}}
{{#set: molecular-weight=328.201}}
+
{{#set: nb reaction found=5}}
 +
{{#set: completion rate=0.71}}
 +
{{#set: nb total reaction=7}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-7185

  • taxonomic-range:
    • tax-2157
    • tax-2759
    • tax-2
  • common-name:
    • utp and ctp dephosphorylation i

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12196 RXN-12196]
  • [NoneRXN-12198 RXN-12198]
  • [NoneRXN-12195 RXN-12195]
  • [NoneRXN-12197 RXN-12197]