Difference between revisions of "PWY-7195"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == * common-name: ** gmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o...")
(Created page with "Category:pathway == Pathway PWY-7195 == * taxonomic-range: ** tax-2157 ** tax-4751 ** tax-2 * common-name: ** pyrimidine ribonucleosides salvage iii == Reaction(s) found =...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] ==
+
== Pathway PWY-7195 ==
 +
* taxonomic-range:
 +
** tax-2157
 +
** tax-4751
 +
** tax-2
 
* common-name:
 
* common-name:
** gmp
+
** pyrimidine ribonucleosides salvage iii
* smiles:
+
== Reaction(s) found ==
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
* [[RXN0-361]]
* inchi-key:
+
== Reaction(s) not found ==
** rqfcjasxjcidsx-uuokfmhzsa-l
+
* [NoneCYTDEAM-RXN CYTDEAM-RXN]
* molecular-weight:
+
{{#set: taxonomic-range=tax-4751|tax-2|tax-2157}}
** 361.207
+
{{#set: common-name=pyrimidine ribonucleosides salvage iii}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[AGPT]]
+
{{#set: completion rate=0.5}}
* [[GMP-REDUCT-RXN]]
+
{{#set: nb total reaction=2}}
* [[GUANPRIBOSYLTRAN-RXN]]
 
* [[GUANYL-KIN-RXN]]
 
* [[RXN-7609]]
 
== Reaction(s) known to produce the compound ==
 
* [[3.6.1.17-RXN]]
 
* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
 
* [[GMP-SYN-GLUT-RXN]]
 
* [[GMP-SYN-NH3-RXN]]
 
* [[GUANOSINE-DIPHOSPHATASE-RXN]]
 
* [[GUANPRIBOSYLTRAN-RXN]]
 
* [[NTDP]]
 
* [[RXN-14140]]
 
* [[RXN-14201]]
 
* [[RXN-15713]]
 
* [[RXN-17923]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=gmp}}
 
{{#set: inchi-key=inchikey=rqfcjasxjcidsx-uuokfmhzsa-l}}
 
{{#set: molecular-weight=361.207}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7195

  • taxonomic-range:
    • tax-2157
    • tax-4751
    • tax-2
  • common-name:
    • pyrimidine ribonucleosides salvage iii

Reaction(s) found

Reaction(s) not found

  • [NoneCYTDEAM-RXN CYTDEAM-RXN]