Difference between revisions of "PWY-7199"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] ==
+== Pathway PWY-7199 ==
+* taxonomic-range:
+** tax-554915
+** tax-33208
+** tax-33090
+** tax-2
+** tax-2157
 * common-name:
-** pristanate
+** pyrimidine deoxyribonucleosides salvage
-* smiles:
+== Reaction(s) found ==
-** cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c
+* [[CYTIDEAM-RXN]]
-* inchi-key:
+* [[THYMIDYLATESYN-RXN]]
-** pahgjzdqxioyth-uhfffaoysa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneTHYKI-RXN THYKI-RXN]
-** 297.5
+* [NoneDURIDKI-RXN DURIDKI-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneDEOXYCYTIDINE-KINASE-RXN DEOXYCYTIDINE-KINASE-RXN]
-* [[RXN66-484]]
+{{#set: taxonomic-range=tax-2157|tax-2|tax-554915|tax-33208|tax-33090}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=pyrimidine deoxyribonucleosides salvage}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=2}}
-{{#set: common-name=pristanate}}
+{{#set: completion rate=0.4}}
-{{#set: inchi-key=inchikey=pahgjzdqxioyth-uhfffaoysa-m}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=297.5}}