Difference between revisions of "PWY-7205"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == * common-name: ** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa * smiles: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == * common-name: ** p-nitrophenyl-α-d-galactopyranoside * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == |
* common-name: | * common-name: | ||
| − | ** | + | ** p-nitrophenyl-α-d-galactopyranoside |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ifbhrqdfsncloz-iirvcbmxsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 301.252 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17830]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=p-nitrophenyl-α-d-galactopyranoside}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ifbhrqdfsncloz-iirvcbmxsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=301.252}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD0-2500
- common-name:
- p-nitrophenyl-α-d-galactopyranoside
- smiles:
- c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
- inchi-key:
- ifbhrqdfsncloz-iirvcbmxsa-n
- molecular-weight:
- 301.252
