Difference between revisions of "PWY-7205"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] ==
+== Pathway PWY66-161 ==
+* taxonomic-range:
+** tax-33208
 * common-name:
-** p-nitrophenyl-&alpha;-d-galactopyranoside
+** ethanol degradation iii
-* smiles:
+== Reaction(s) found ==
-** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
+* [[ACETATE--COA-LIGASE-RXN]]
-* inchi-key:
+* [[RXN66-3]]
-** ifbhrqdfsncloz-iirvcbmxsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN66-2 RXN66-2]
-** 301.252
+{{#set: taxonomic-range=tax-33208}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=ethanol degradation iii}}
-* [[RXN-17830]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.67}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=p-nitrophenyl-&alpha;-d-galactopyranoside}}
-{{#set: inchi-key=inchikey=ifbhrqdfsncloz-iirvcbmxsa-n}}
-{{#set: molecular-weight=301.252}}