Difference between revisions of "PWY-7206"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14425 CPD-14425] ==
+== Pathway PWY-7206 ==
+* taxonomic-range:
+** tax-2157
+** tax-2
+** tax-33208
+** tax-33090
 * common-name:
-** (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa
+** pyrimidine deoxyribonucleotides dephosphorylation
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[DCTP-PYROPHOSPHATASE-RXN]]
-* inchi-key:
+* [[DUTP-PYROP-RXN]]
-** hgvxutaezaltig-hkhrklhhsa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-14188 RXN-14188]
-** 1073.981
+{{#set: taxonomic-range=tax-33208|tax-2|tax-2157|tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=pyrimidine deoxyribonucleotides dephosphorylation}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[RXN-13444]]
+{{#set: completion rate=0.67}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=(2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa}}
-{{#set: inchi-key=inchikey=hgvxutaezaltig-hkhrklhhsa-j}}
-{{#set: molecular-weight=1073.981}}