Difference between revisions of "PWY-7216"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTOL PHYTOL] == * common-name: ** phytol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cco * inchi-...") |
(Created page with "Category:pathway == Pathway PWY-7216 == * taxonomic-range: ** tax-2 * common-name: ** (r)- and (s)-3-hydroxybutanoate biosynthesis (engineered) == Reaction(s) found == * [...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway PWY-7216 == |
+ | * taxonomic-range: | ||
+ | ** tax-2 | ||
* common-name: | * common-name: | ||
− | ** | + | ** (r)- and (s)-3-hydroxybutanoate biosynthesis (engineered) |
− | + | == Reaction(s) found == | |
− | + | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] | |
− | * | + | * [[RXN-11662]] |
− | + | * [[RXN-5901]] | |
− | * | + | == Reaction(s) not found == |
− | * | + | * [NoneRXN-14255 RXN-14255] |
− | == Reaction(s) | + | * [NoneRXN-14251 RXN-14251] |
− | * [ | + | {{#set: taxonomic-range=tax-2}} |
− | * [ | + | {{#set: common-name=(r)- and (s)-3-hydroxybutanoate biosynthesis (engineered)}} |
− | == | + | {{#set: nb reaction found=3}} |
− | + | {{#set: completion rate=0.6}} | |
− | {{#set: | + | {{#set: nb total reaction=5}} |
− | {{#set: | ||
− | {{#set: |
Latest revision as of 10:57, 18 March 2021
Pathway PWY-7216
- taxonomic-range:
- tax-2
- common-name:
- (r)- and (s)-3-hydroxybutanoate biosynthesis (engineered)
Reaction(s) found
Reaction(s) not found
- [NoneRXN-14255 RXN-14255]
- [NoneRXN-14251 RXN-14251]