Difference between revisions of "PWY-7216"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTOL PHYTOL] ==
+== Pathway PWY-7216 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** phytol
+** (r)- and (s)-3-hydroxybutanoate biosynthesis (engineered)
-* smiles:
+== Reaction(s) found ==
-** cc(c)cccc(c)cccc(c)cccc(c)=cco
+* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
-* inchi-key:
+* [[RXN-11662]]
-** botwfxyspfmfnr-pyddkjgssa-n
+* [[RXN-5901]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 296.535
+* [NoneRXN-14255 RXN-14255]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-14251 RXN-14251]
-* [[RXN-7683]]
+{{#set: taxonomic-range=tax-2}}
-* [[RXN66-478]]
+{{#set: common-name=(r)- and (s)-3-hydroxybutanoate biosynthesis (engineered)}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=3}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.6}}
-{{#set: common-name=phytol}}
+{{#set: nb total reaction=5}}
-{{#set: inchi-key=inchikey=botwfxyspfmfnr-pyddkjgssa-n}}
-{{#set: molecular-weight=296.535}}