Difference between revisions of "PWY-7216"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * common-name: ** pregn-5-ene-3,20-dione-17-ol * smiles: ** cc(=o)c4(o)(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HG+2 HG+2] == * common-name: ** hg2+ * smiles: ** [hg++] * inchi-key: ** bqpiggfysbelgy-uhfffao...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HG+2 HG+2] ==
 
* common-name:
 
* common-name:
** pregn-5-ene-3,20-dione-17-ol
+
** hg2+
 
* smiles:
 
* smiles:
** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4))
+
** [hg++]
 
* inchi-key:
 
* inchi-key:
** rcfjdvcranozel-uhfffaoysa-n
+
** bqpiggfysbelgy-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 330.466
+
** 200.59
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-350]]
+
* [[MERCURY-II-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-350]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pregn-5-ene-3,20-dione-17-ol}}
+
{{#set: common-name=hg2+}}
{{#set: inchi-key=inchikey=rcfjdvcranozel-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=bqpiggfysbelgy-uhfffaoysa-n}}
{{#set: molecular-weight=330.466}}
+
{{#set: molecular-weight=200.59}}

Revision as of 14:18, 26 August 2019

Metabolite HG+2

  • common-name:
    • hg2+
  • smiles:
    • [hg++]
  • inchi-key:
    • bqpiggfysbelgy-uhfffaoysa-n
  • molecular-weight:
    • 200.59

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality