Difference between revisions of "PWY-7216"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HG+2 HG+2] == * common-name: ** hg2+ * smiles: ** [hg++] * inchi-key: ** bqpiggfysbelgy-uhfffao...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTOL PHYTOL] == * common-name: ** phytol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cco * inchi-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTOL PHYTOL] == |
* common-name: | * common-name: | ||
| − | ** | + | ** phytol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)cccc(c)cccc(c)cccc(c)=cco |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** botwfxyspfmfnr-pyddkjgssa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 296.535 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7683]] |
| + | * [[RXN66-478]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phytol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=botwfxyspfmfnr-pyddkjgssa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=296.535}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite PHYTOL
- common-name:
- phytol
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)=cco
- inchi-key:
- botwfxyspfmfnr-pyddkjgssa-n
- molecular-weight:
- 296.535
