Difference between revisions of "PWY-7221"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] ==
+== Pathway PWY-3101 ==
+* taxonomic-range:
+** tax-58024
 * common-name:
-** 3-oxopentanoyl-coa
+** flavonol biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN-12510]]
-* inchi-key:
+* [[RXN-527]]
-** wioqnwtzboqteu-zmhdxicwsa-j
+* [[RXN-8450]]
-* molecular-weight:
+* [[RXN1F-93]]
-** 861.604
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-13718 RXN-13718]
-* [[RXN-12561]]
+* [NoneRXN-525 RXN-525]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-7782 RXN-7782]
-* [[RXN-12560]]
+{{#set: taxonomic-range=tax-58024}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=flavonol biosynthesis}}
-{{#set: common-name=3-oxopentanoyl-coa}}
+{{#set: nb reaction found=4}}
-{{#set: inchi-key=inchikey=wioqnwtzboqteu-zmhdxicwsa-j}}
+{{#set: completion rate=0.57}}
-{{#set: molecular-weight=861.604}}
+{{#set: nb total reaction=7}}