Difference between revisions of "PWY-723"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17368 CPD-17368] == * common-name: ** trans-adre-2-enoyl-coa * smiles: ** cccccc=ccc=ccc=cc...")
(Created page with "Category:pathway == Pathway PWY-723 == * taxonomic-range: ** tax-4751 * common-name: ** alkylnitronates degradation == Reaction(s) found == * 2-NITROPROPANE-DIOXYGENASE-...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17368 CPD-17368] ==
+
== Pathway PWY-723 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** trans-adre-2-enoyl-coa
+
** alkylnitronates degradation
* smiles:
+
== Reaction(s) found ==
** cccccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
* inchi-key:
+
* [[RXN0-6377]]
** xsibquoflnivek-xpbiuritsa-j
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 1075.997
+
{{#set: taxonomic-range=tax-4751}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=alkylnitronates degradation}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=2}}
* [[RXN-16113]]
+
{{#set: completion rate=1.0}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=2}}
{{#set: common-name=trans-adre-2-enoyl-coa}}
 
{{#set: inchi-key=inchikey=xsibquoflnivek-xpbiuritsa-j}}
 
{{#set: molecular-weight=1075.997}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-723

  • taxonomic-range:
    • tax-4751
  • common-name:
    • alkylnitronates degradation

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present