Difference between revisions of "PWY-723"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2190 CPD-2190] == * common-name: ** 1-18:3-2-16:3-monogalactosyldiacylglycerol * smiles: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17368 CPD-17368] == * common-name: ** trans-adre-2-enoyl-coa * smiles: ** cccccc=ccc=ccc=cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17368 CPD-17368] == |
* common-name: | * common-name: | ||
− | ** | + | ** trans-adre-2-enoyl-coa |
* smiles: | * smiles: | ||
− | ** ccc=ccc=ccc= | + | ** cccccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xsibquoflnivek-xpbiuritsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1075.997 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16113]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=trans-adre-2-enoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xsibquoflnivek-xpbiuritsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1075.997}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-17368
- common-name:
- trans-adre-2-enoyl-coa
- smiles:
- cccccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- xsibquoflnivek-xpbiuritsa-j
- molecular-weight:
- 1075.997