Difference between revisions of "PWY-7233"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] ==
+== Pathway PWY-581 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** 4-hydroxy-2-nonenal-[l-cys] conjugate
+** indole-3-acetate biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** cccccc(o)c(cc=o)scc([n+])c(=o)[o-]
+* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
-* inchi-key:
+* [[RXN-1404]]
-** salpdushmtyyoh-uhfffaoysa-n
+* [[RXNDQC-2]]
-* molecular-weight:
+* [[RXNN-404]]
-** 277.378
+* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
-== Reaction(s) known to consume the compound ==
+== Reaction(s) not found ==
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-12063 RXN-12063]
-* [[RXN-13677]]
+* [NoneRXN-19838 RXN-19838]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-7567 RXN-7567]
-{{#set: common-name=4-hydroxy-2-nonenal-[l-cys] conjugate}}
+* [NoneRXN-1406 RXN-1406]
-{{#set: inchi-key=inchikey=salpdushmtyyoh-uhfffaoysa-n}}
+* [NoneRXN-1405 RXN-1405]
-{{#set: molecular-weight=277.378}}
+* [NoneRXN-12061 RXN-12061]
+* [NoneRXN-12062 RXN-12062]
+{{#set: taxonomic-range=tax-33090}}
+{{#set: common-name=indole-3-acetate biosynthesis ii}}
+{{#set: nb reaction found=5}}
+{{#set: completion rate=0.42}}
+{{#set: nb total reaction=12}}