Difference between revisions of "PWY-7234"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18491 CPD-18491] ==
+== Pathway PWY-7234 ==
+* taxonomic-range:
+** tax-2157
 * common-name:
-** (6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
+** inosine-5'-phosphate biosynthesis iii
-* smiles:
+== Reaction(s) found ==
-** cccccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+* [[AICARSYN-RXN]]
-* inchi-key:
+* [[IMPCYCLOHYDROLASE-RXN]]
-** xzynvqdkyrhkfg-qojzhlsosa-j
+* [[SAICARSYN-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 1104.05
+* [NoneRXN0-743 RXN0-743]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-10066 RXN-10066]
-* [[RXN-17113]]
+* [NoneRXN0-742 RXN0-742]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2157}}
-* [[RXN-17112]]
+{{#set: common-name=inosine-5'-phosphate biosynthesis iii}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=3}}
-{{#set: common-name=(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
+{{#set: completion rate=0.5}}
-{{#set: inchi-key=inchikey=xzynvqdkyrhkfg-qojzhlsosa-j}}
+{{#set: nb total reaction=6}}
-{{#set: molecular-weight=1104.05}}