Difference between revisions of "PWY-7235"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * common-name: ** 5-chloro-5-deoxy-d-ribonate * smiles: ** c(=o)([o-])c...")
(Created page with "Category:pathway == Pathway PWY-7235 == * taxonomic-range: ** tax-4751 * common-name: ** superpathway of ubiquinol-6 biosynthesis (eukaryotic) == Reaction(s) found == * ...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] ==
+
== Pathway PWY-7235 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** 5-chloro-5-deoxy-d-ribonate
+
** superpathway of ubiquinol-6 biosynthesis (eukaryotic)
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])c(o)c(o)c(o)ccl
+
* [[2.1.1.114-RXN]]
* inchi-key:
+
* [[RXN-9003]]
** ijqsocfskcenow-bxxzvtaosa-m
+
== Reaction(s) not found ==
* molecular-weight:
+
No padmetRef was given during wikipage creation or pathway not in metacyc, data not available
** 183.568
+
{{#set: taxonomic-range=tax-4751}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=superpathway of ubiquinol-6 biosynthesis (eukaryotic)}}
* [[RXN-11717]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=n.a}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=n.a}}
{{#set: common-name=5-chloro-5-deoxy-d-ribonate}}
 
{{#set: inchi-key=inchikey=ijqsocfskcenow-bxxzvtaosa-m}}
 
{{#set: molecular-weight=183.568}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-7235

  • taxonomic-range:
    • tax-4751
  • common-name:
    • superpathway of ubiquinol-6 biosynthesis (eukaryotic)

Reaction(s) found

Reaction(s) not found

No padmetRef was given during wikipage creation or pathway not in metacyc, data not available