Difference between revisions of "PWY-7235"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-containing-diamino-hydro-formamidops DNA-containing-diamino-hydro-formamidops] == * common-...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * common-name: ** 5-chloro-5-deoxy-d-ribonate * smiles: ** c(=o)([o-])c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-containing-diamino-hydro-formamidops DNA-containing-diamino-hydro-formamidops] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] ==
 
* common-name:
 
* common-name:
** a ring-opened 7-methylguanine in dna
+
** 5-chloro-5-deoxy-d-ribonate
 +
* smiles:
 +
** c(=o)([o-])c(o)c(o)c(o)ccl
 +
* inchi-key:
 +
** ijqsocfskcenow-bxxzvtaosa-m
 +
* molecular-weight:
 +
** 183.568
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.2.23-RXN]]
+
* [[RXN-11717]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a ring-opened 7-methylguanine in dna}}
+
{{#set: common-name=5-chloro-5-deoxy-d-ribonate}}
 +
{{#set: inchi-key=inchikey=ijqsocfskcenow-bxxzvtaosa-m}}
 +
{{#set: molecular-weight=183.568}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-12673

  • common-name:
    • 5-chloro-5-deoxy-d-ribonate
  • smiles:
    • c(=o)([o-])c(o)c(o)c(o)ccl
  • inchi-key:
    • ijqsocfskcenow-bxxzvtaosa-m
  • molecular-weight:
    • 183.568

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality