Difference between revisions of "PWY-7237"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMMA-LINOLENOYL-COA GAMMA-LINOLENOYL-COA] ==
+== Pathway PWY-7237 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** &gamma;-linolenoyl-coa
+** myo-, chiro- and scyllo-inositol degradation
-* smiles:
+== Reaction(s) found ==
-** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
-* inchi-key:
+* [[RXN-13779]]
-** xzqyptbyqyzgru-fhdveodpsa-j
+* [[RXN-14148]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 1023.921
+* [NoneRXN-14178 RXN-14178]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-* [[RXN-12777]]
+{{#set: common-name=myo-, chiro- and scyllo-inositol degradation}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=3}}
-* [[1.14.19.3-RXN]]
+{{#set: completion rate=0.75}}
-* [[RXN-16043]]
+{{#set: nb total reaction=4}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=&gamma;-linolenoyl-coa}}
-{{#set: inchi-key=inchikey=xzqyptbyqyzgru-fhdveodpsa-j}}
-{{#set: molecular-weight=1023.921}}